C18H26BrClN2O3 — CID 119612214
N-[2-(aminomethyl)cyclohexyl]-4-(5-bromo-2-methoxyphenyl)-4-oxobutanamide;hydrochloride (PubChem CID 119612214) has the molecular formula C18H26BrClN2O3 and a molecular weight of 433.77 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-4-(5-bromo-2-methoxyphenyl)-4-oxobutanamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-4-(5-bromo-2-methoxyphenyl)-4-oxobutanamide;hydrochloride |
|---|---|
| PubChem CID | 119612214 |
| Molecular Formula | C18H26BrClN2O3 |
| Molecular Weight | 433.77 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-4-(5-bromo-2-methoxyphenyl)-4-oxobutanamide;hydrochloride |
| SMILES | COc1ccc(Br)cc1C(=O)CCC(=O)NC1CCCCC1CN.Cl |
| InChI | InChI=1S/C18H25BrN2O3.ClH/c1-24-17-8-6-13(19)10-14(17)16(22)7-9-18(23)21-15-5-3-2-4-12(15)11-20;/h6,8,10,12,15H,2-5,7,9,11,20H2,1H3,(H,21,23);1H |
| InChIKey | CCRCVZSADKWSOB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.77 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |