C23H27N3O7 — CID 18860056
2,2-dimethyl-N-[(E)-3-(4-nitroanilino)-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]propanamide (PubChem CID 18860056) has the molecular formula C23H27N3O7 and a molecular weight of 457.48 g/mol. Its IUPAC name is 2,2-dimethyl-N-[(E)-3-(4-nitroanilino)-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]propanamide.
| Compound Name | 2,2-dimethyl-N-[(E)-3-(4-nitroanilino)-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]propanamide |
|---|---|
| PubChem CID | 18860056 |
| Molecular Formula | C23H27N3O7 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 2,2-dimethyl-N-[(E)-3-(4-nitroanilino)-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]propanamide |
| SMILES | COc1cc(/C=C(/NC(=O)C(C)(C)C)C(=O)Nc2ccc([N+](=O)[O-])cc2)cc(OC)c1OC |
| InChI | InChI=1S/C23H27N3O7/c1-23(2,3)22(28)25-17(21(27)24-15-7-9-16(10-8-15)26(29)30)11-14-12-18(31-4)20(33-6)19(13-14)32-5/h7-13H,1-6H3,(H,24,27)(H,25,28)/b17-11+ |
| InChIKey | MZPSNOJZPNXOPK-GZTJUZNOSA-N |
| XLogP | 3.76 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|