C28H27N3O6 — CID 46497448
methyl 4-[[(Z)-2-[(4-tert-butylbenzoyl)amino]-3-(4-nitrophenyl)prop-2-enoyl]amino]benzoate (PubChem CID 46497448) has the molecular formula C28H27N3O6 and a molecular weight of 501.54 g/mol. Its IUPAC name is methyl 4-[[(Z)-2-[(4-tert-butylbenzoyl)amino]-3-(4-nitrophenyl)prop-2-enoyl]amino]benzoate.
| Compound Name | methyl 4-[[(Z)-2-[(4-tert-butylbenzoyl)amino]-3-(4-nitrophenyl)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 46497448 |
| Molecular Formula | C28H27N3O6 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | methyl 4-[[(Z)-2-[(4-tert-butylbenzoyl)amino]-3-(4-nitrophenyl)prop-2-enoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)/C(=C/c2ccc([N+](=O)[O-])cc2)NC(=O)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H27N3O6/c1-28(2,3)21-11-7-19(8-12-21)25(32)30-24(17-18-5-15-23(16-6-18)31(35)36)26(33)29-22-13-9-20(10-14-22)27(34)37-4/h5-17H,1-4H3,(H,29,33)(H,30,32)/b24-17- |
| InChIKey | FHEDDNPYQIFBJI-ULJHMMPZSA-N |
| XLogP | 5.09 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|