C23H18FN3O4 — CID 46497162
N-[(Z)-3-(4-fluoroanilino)-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]-3-methylbenzamide (PubChem CID 46497162) has the molecular formula C23H18FN3O4 and a molecular weight of 419.41 g/mol. Its IUPAC name is N-[(Z)-3-(4-fluoroanilino)-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]-3-methylbenzamide.
| Compound Name | N-[(Z)-3-(4-fluoroanilino)-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 46497162 |
| Molecular Formula | C23H18FN3O4 |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | N-[(Z)-3-(4-fluoroanilino)-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)N/C(=C\c2ccc([N+](=O)[O-])cc2)C(=O)Nc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C23H18FN3O4/c1-15-3-2-4-17(13-15)22(28)26-21(14-16-5-11-20(12-6-16)27(30)31)23(29)25-19-9-7-18(24)8-10-19/h2-14H,1H3,(H,25,29)(H,26,28)/b21-14- |
| InChIKey | LETHSOXOLYYVTI-STZFKDTASA-N |
| XLogP | 4.45 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|