C27H26N4O7 — CID 46497449
4-tert-butyl-N-[(Z)-3-(2-methoxy-4-nitroanilino)-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 46497449) has the molecular formula C27H26N4O7 and a molecular weight of 518.53 g/mol. Its IUPAC name is 4-tert-butyl-N-[(Z)-3-(2-methoxy-4-nitroanilino)-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[(Z)-3-(2-methoxy-4-nitroanilino)-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 46497449 |
| Molecular Formula | C27H26N4O7 |
| Molecular Weight | 518.53 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | 4-tert-butyl-N-[(Z)-3-(2-methoxy-4-nitroanilino)-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)/C(=C/c1ccc([N+](=O)[O-])cc1)NC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C27H26N4O7/c1-27(2,3)19-9-7-18(8-10-19)25(32)29-23(15-17-5-11-20(12-6-17)30(34)35)26(33)28-22-14-13-21(31(36)37)16-24(22)38-4/h5-16H,1-4H3,(H,28,33)(H,29,32)/b23-15- |
| InChIKey | ZKHOBVXCHOVCHW-HAHDFKILSA-N |
| XLogP | 5.22 |
| TPSA | 153.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|