C20H19Cl2N3O4 — CID 18860088
N-[(E)-1-(2,6-dichlorophenyl)-3-(4-nitroanilino)-3-oxoprop-1-en-2-yl]-2,2-dimethylpropanamide (PubChem CID 18860088) has the molecular formula C20H19Cl2N3O4 and a molecular weight of 436.30 g/mol. Its IUPAC name is N-[(E)-1-(2,6-dichlorophenyl)-3-(4-nitroanilino)-3-oxoprop-1-en-2-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[(E)-1-(2,6-dichlorophenyl)-3-(4-nitroanilino)-3-oxoprop-1-en-2-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 18860088 |
| Molecular Formula | C20H19Cl2N3O4 |
| Molecular Weight | 436.30 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | N-[(E)-1-(2,6-dichlorophenyl)-3-(4-nitroanilino)-3-oxoprop-1-en-2-yl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)N/C(=C/c1c(Cl)cccc1Cl)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H19Cl2N3O4/c1-20(2,3)19(27)24-17(11-14-15(21)5-4-6-16(14)22)18(26)23-12-7-9-13(10-8-12)25(28)29/h4-11H,1-3H3,(H,23,26)(H,24,27)/b17-11+ |
| InChIKey | SRHIZIKEWQUYMT-GZTJUZNOSA-N |
| XLogP | 5.04 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.30 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|