C20H21Cl2N3O4S — CID 18860092
N-[(E)-1-(2,6-dichlorophenyl)-3-oxo-3-(4-sulfamoylanilino)prop-1-en-2-yl]-2,2-dimethylpropanamide (PubChem CID 18860092) has the molecular formula C20H21Cl2N3O4S and a molecular weight of 470.38 g/mol. Its IUPAC name is N-[(E)-1-(2,6-dichlorophenyl)-3-oxo-3-(4-sulfamoylanilino)prop-1-en-2-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[(E)-1-(2,6-dichlorophenyl)-3-oxo-3-(4-sulfamoylanilino)prop-1-en-2-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 18860092 |
| Molecular Formula | C20H21Cl2N3O4S |
| Molecular Weight | 470.38 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | N-[(E)-1-(2,6-dichlorophenyl)-3-oxo-3-(4-sulfamoylanilino)prop-1-en-2-yl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)N/C(=C/c1c(Cl)cccc1Cl)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C20H21Cl2N3O4S/c1-20(2,3)19(27)25-17(11-14-15(21)5-4-6-16(14)22)18(26)24-12-7-9-13(10-8-12)30(23,28)29/h4-11H,1-3H3,(H,24,26)(H,25,27)(H2,23,28,29)/b17-11+ |
| InChIKey | AAVONLAAUWUVPG-GZTJUZNOSA-N |
| XLogP | 3.78 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|