C13H19NO3 — CID 142155659
(Z)-N-methyl-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-amine (PubChem CID 142155659) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is (Z)-N-methyl-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-amine.
| Compound Name | (Z)-N-methyl-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-amine |
|---|---|
| PubChem CID | 142155659 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | (Z)-N-methyl-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-amine |
| SMILES | CN/C(C)=C\c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C13H19NO3/c1-9(14-2)6-10-7-11(15-3)13(17-5)12(8-10)16-4/h6-8,14H,1-5H3/b9-6- |
| InChIKey | IKZLCFFGFDQKDH-TWGQIWQCSA-N |
| XLogP | 2.29 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |