C15H22O4 — CID 6446799
(E)-4-methyl-1-(3,4,5-trimethoxyphenyl)pent-1-en-3-ol (PubChem CID 6446799) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (E)-4-methyl-1-(3,4,5-trimethoxyphenyl)pent-1-en-3-ol.
| Compound Name | (E)-4-methyl-1-(3,4,5-trimethoxyphenyl)pent-1-en-3-ol |
|---|---|
| PubChem CID | 6446799 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (E)-4-methyl-1-(3,4,5-trimethoxyphenyl)pent-1-en-3-ol |
| SMILES | COc1cc(/C=C/C(O)C(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C15H22O4/c1-10(2)12(16)7-6-11-8-13(17-3)15(19-5)14(9-11)18-4/h6-10,12,16H,1-5H3/b7-6+ |
| InChIKey | SJWYLBIDXWSXKG-VOTSOKGWSA-N |
| XLogP | 2.74 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |