C15H22O3 — CID 142222347
1,2,3-trimethoxy-5-[(E)-3-methylpent-1-enyl]benzene (PubChem CID 142222347) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1,2,3-trimethoxy-5-[(E)-3-methylpent-1-enyl]benzene.
| Compound Name | 1,2,3-trimethoxy-5-[(E)-3-methylpent-1-enyl]benzene |
|---|---|
| PubChem CID | 142222347 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 1,2,3-trimethoxy-5-[(E)-3-methylpent-1-enyl]benzene |
| SMILES | CCC(C)/C=C/c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C15H22O3/c1-6-11(2)7-8-12-9-13(16-3)15(18-5)14(10-12)17-4/h7-11H,6H2,1-5H3/b8-7+ |
| InChIKey | LSUVFKMHVXGGON-BQYQJAHWSA-N |
| XLogP | 3.77 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |