C15H22O3 — CID 20785899
5-[(E)-3,3-dimethylbut-1-enyl]-1,2,3-trimethoxybenzene (PubChem CID 20785899) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 5-[(E)-3,3-dimethylbut-1-enyl]-1,2,3-trimethoxybenzene.
| Compound Name | 5-[(E)-3,3-dimethylbut-1-enyl]-1,2,3-trimethoxybenzene |
|---|---|
| PubChem CID | 20785899 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 5-[(E)-3,3-dimethylbut-1-enyl]-1,2,3-trimethoxybenzene |
| SMILES | COc1cc(/C=C/C(C)(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C15H22O3/c1-15(2,3)8-7-11-9-12(16-4)14(18-6)13(10-11)17-5/h7-10H,1-6H3/b8-7+ |
| InChIKey | QYKNYELTGOGLKM-BQYQJAHWSA-N |
| XLogP | 3.77 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |