C16H24O4 — CID 3045164
4,4-dimethyl-1-(3,4,5-trimethoxyphenyl)pent-1-en-3-ol (PubChem CID 3045164) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 4,4-dimethyl-1-(3,4,5-trimethoxyphenyl)pent-1-en-3-ol.
| Compound Name | 4,4-dimethyl-1-(3,4,5-trimethoxyphenyl)pent-1-en-3-ol |
|---|---|
| PubChem CID | 3045164 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 4,4-dimethyl-1-(3,4,5-trimethoxyphenyl)pent-1-en-3-ol |
| SMILES | COc1cc(C=CC(O)C(C)(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C16H24O4/c1-16(2,3)14(17)8-7-11-9-12(18-4)15(20-6)13(10-11)19-5/h7-10,14,17H,1-6H3 |
| InChIKey | LVYHQBFMMMDUTF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |