C13H15F3O4 — CID 132528887
1,2,3-trimethoxy-5-[(E)-2-(2,2,2-trifluoroethoxy)ethenyl]benzene (PubChem CID 132528887) has the molecular formula C13H15F3O4 and a molecular weight of 292.25 g/mol. Its IUPAC name is 1,2,3-trimethoxy-5-[(E)-2-(2,2,2-trifluoroethoxy)ethenyl]benzene.
| Compound Name | 1,2,3-trimethoxy-5-[(E)-2-(2,2,2-trifluoroethoxy)ethenyl]benzene |
|---|---|
| PubChem CID | 132528887 |
| Molecular Formula | C13H15F3O4 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 1,2,3-trimethoxy-5-[(E)-2-(2,2,2-trifluoroethoxy)ethenyl]benzene |
| SMILES | COc1cc(/C=C/OCC(F)(F)F)cc(OC)c1OC |
| InChI | InChI=1S/C13H15F3O4/c1-17-10-6-9(4-5-20-8-13(14,15)16)7-11(18-2)12(10)19-3/h4-7H,8H2,1-3H3/b5-4+ |
| InChIKey | PAXNKVQCAXIFPT-SNAWJCMRSA-N |
| XLogP | 3.26 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|