C28H37F3N2O5 — CID 167072051
3-(dipropylamino)-N-[2-(2,2,2-trifluoroethoxy)-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]propanamide (PubChem CID 167072051) has the molecular formula C28H37F3N2O5 and a molecular weight of 538.61 g/mol. Its IUPAC name is 3-(dipropylamino)-N-[2-(2,2,2-trifluoroethoxy)-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]propanamide.
| Compound Name | 3-(dipropylamino)-N-[2-(2,2,2-trifluoroethoxy)-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]propanamide |
|---|---|
| PubChem CID | 167072051 |
| Molecular Formula | C28H37F3N2O5 |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | 3-(dipropylamino)-N-[2-(2,2,2-trifluoroethoxy)-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]propanamide |
| SMILES | CCCN(CCC)CCC(=O)Nc1cc(/C=C\c2cc(OC)c(OC)c(OC)c2)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C28H37F3N2O5/c1-6-13-33(14-7-2)15-12-26(34)32-22-16-20(10-11-23(22)38-19-28(29,30)31)8-9-21-17-24(35-3)27(37-5)25(18-21)36-4/h8-11,16-18H,6-7,12-15,19H2,1-5H3,(H,32,34)/b9-8- |
| InChIKey | HGZYKWXDAONVHO-HJWRWDBZSA-N |
| XLogP | 6.27 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|