C26H36N2O5 — CID 170547906
3-(diethylamino)-N-[5-ethoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]propanamide (PubChem CID 170547906) has the molecular formula C26H36N2O5 and a molecular weight of 456.58 g/mol. Its IUPAC name is 3-(diethylamino)-N-[5-ethoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]propanamide.
| Compound Name | 3-(diethylamino)-N-[5-ethoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]propanamide |
|---|---|
| PubChem CID | 170547906 |
| Molecular Formula | C26H36N2O5 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | 3-(diethylamino)-N-[5-ethoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]propanamide |
| SMILES | CCOc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)c(NC(=O)CCN(CC)CC)c1 |
| InChI | InChI=1S/C26H36N2O5/c1-7-28(8-2)15-14-25(29)27-22-18-21(33-9-3)13-12-20(22)11-10-19-16-23(30-4)26(32-6)24(17-19)31-5/h10-13,16-18H,7-9,14-15H2,1-6H3,(H,27,29)/b11-10- |
| InChIKey | KGUQCFTZJKHCDW-KHPPLWFESA-N |
| XLogP | 4.95 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|