C25H35NO6 — CID 21446850
(Z)-N,N-diethyl-2,3-bis(3,4,5-trimethoxyphenyl)prop-2-en-1-amine (PubChem CID 21446850) has the molecular formula C25H35NO6 and a molecular weight of 445.56 g/mol. Its IUPAC name is (Z)-N,N-diethyl-2,3-bis(3,4,5-trimethoxyphenyl)prop-2-en-1-amine.
| Compound Name | (Z)-N,N-diethyl-2,3-bis(3,4,5-trimethoxyphenyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 21446850 |
| Molecular Formula | C25H35NO6 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | (Z)-N,N-diethyl-2,3-bis(3,4,5-trimethoxyphenyl)prop-2-en-1-amine |
| SMILES | CCN(CC)C/C(=C\c1cc(OC)c(OC)c(OC)c1)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C25H35NO6/c1-9-26(10-2)16-19(18-14-22(29-5)25(32-8)23(15-18)30-6)11-17-12-20(27-3)24(31-7)21(13-17)28-4/h11-15H,9-10,16H2,1-8H3/b19-11+ |
| InChIKey | LHCLGHSTLRDFSC-YBFXNURJSA-N |
| XLogP | 4.62 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|