C28H39N3O8 — CID 6366824
N-[(Z)-3-[2-(diethylamino)ethylamino]-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-enyl]-3,4,5-trimethoxybenzamide (PubChem CID 6366824) has the molecular formula C28H39N3O8 and a molecular weight of 545.63 g/mol. Its IUPAC name is N-[(Z)-3-[2-(diethylamino)ethylamino]-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-enyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(Z)-3-[2-(diethylamino)ethylamino]-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-enyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 6366824 |
| Molecular Formula | C28H39N3O8 |
| Molecular Weight | 545.63 g/mol |
| Exact Mass | 545.27 |
| IUPAC Name | N-[(Z)-3-[2-(diethylamino)ethylamino]-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-enyl]-3,4,5-trimethoxybenzamide |
| SMILES | CCN(CC)CCNC(=O)/C=C(\NC(=O)c1cc(OC)c(OC)c(OC)c1)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C28H39N3O8/c1-9-31(10-2)12-11-29-25(32)17-20(18-13-21(34-3)26(38-7)22(14-18)35-4)30-28(33)19-15-23(36-5)27(39-8)24(16-19)37-6/h13-17H,9-12H2,1-8H3,(H,29,32)(H,30,33)/b20-17- |
| InChIKey | ROXHPLUHHGPGDM-JZJYNLBNSA-N |
| XLogP | 2.97 |
| TPSA | 116.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.63 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|