C26H35N3O6 — CID 102115441
N-[(E)-3-[2-(diethylamino)ethylamino]-1-(2-methoxyphenyl)-3-oxoprop-1-en-2-yl]-3,4,5-trimethoxybenzamide (PubChem CID 102115441) has the molecular formula C26H35N3O6 and a molecular weight of 485.58 g/mol. Its IUPAC name is N-[(E)-3-[2-(diethylamino)ethylamino]-1-(2-methoxyphenyl)-3-oxoprop-1-en-2-yl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(E)-3-[2-(diethylamino)ethylamino]-1-(2-methoxyphenyl)-3-oxoprop-1-en-2-yl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 102115441 |
| Molecular Formula | C26H35N3O6 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | N-[(E)-3-[2-(diethylamino)ethylamino]-1-(2-methoxyphenyl)-3-oxoprop-1-en-2-yl]-3,4,5-trimethoxybenzamide |
| SMILES | CCN(CC)CCNC(=O)/C(=C\c1ccccc1OC)NC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C26H35N3O6/c1-7-29(8-2)14-13-27-26(31)20(15-18-11-9-10-12-21(18)32-3)28-25(30)19-16-22(33-4)24(35-6)23(17-19)34-5/h9-12,15-17H,7-8,13-14H2,1-6H3,(H,27,31)(H,28,30)/b20-15+ |
| InChIKey | NKDMADWJOGOELA-HMMYKYKNSA-N |
| XLogP | 2.95 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|