C29H38N4O5 — CID 3562693
N-[3-[2-(diethylamino)ethylamino]-1-(1-ethylindol-3-yl)-3-oxoprop-1-en-2-yl]-3,4,5-trimethoxybenzamide (PubChem CID 3562693) has the molecular formula C29H38N4O5 and a molecular weight of 522.65 g/mol. Its IUPAC name is N-[3-[2-(diethylamino)ethylamino]-1-(1-ethylindol-3-yl)-3-oxoprop-1-en-2-yl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[3-[2-(diethylamino)ethylamino]-1-(1-ethylindol-3-yl)-3-oxoprop-1-en-2-yl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 3562693 |
| Molecular Formula | C29H38N4O5 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | N-[3-[2-(diethylamino)ethylamino]-1-(1-ethylindol-3-yl)-3-oxoprop-1-en-2-yl]-3,4,5-trimethoxybenzamide |
| SMILES | CCN(CC)CCNC(=O)C(=Cc1cn(CC)c2ccccc12)NC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C29H38N4O5/c1-7-32(8-2)15-14-30-29(35)23(16-21-19-33(9-3)24-13-11-10-12-22(21)24)31-28(34)20-17-25(36-4)27(38-6)26(18-20)37-5/h10-13,16-19H,7-9,14-15H2,1-6H3,(H,30,35)(H,31,34) |
| InChIKey | PLSBUBFUFVAWAB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|