C31H31N3O5 — CID 3986882
N-[3-(2,3-dihydroindol-1-yl)-1-(1-ethylindol-3-yl)-3-oxoprop-1-en-2-yl]-3,4,5-trimethoxybenzamide (PubChem CID 3986882) has the molecular formula C31H31N3O5 and a molecular weight of 525.61 g/mol. Its IUPAC name is N-[3-(2,3-dihydroindol-1-yl)-1-(1-ethylindol-3-yl)-3-oxoprop-1-en-2-yl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[3-(2,3-dihydroindol-1-yl)-1-(1-ethylindol-3-yl)-3-oxoprop-1-en-2-yl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 3986882 |
| Molecular Formula | C31H31N3O5 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | N-[3-(2,3-dihydroindol-1-yl)-1-(1-ethylindol-3-yl)-3-oxoprop-1-en-2-yl]-3,4,5-trimethoxybenzamide |
| SMILES | CCn1cc(C=C(NC(=O)c2cc(OC)c(OC)c(OC)c2)C(=O)N2CCc3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C31H31N3O5/c1-5-33-19-22(23-11-7-9-13-26(23)33)16-24(31(36)34-15-14-20-10-6-8-12-25(20)34)32-30(35)21-17-27(37-2)29(39-4)28(18-21)38-3/h6-13,16-19H,5,14-15H2,1-4H3,(H,32,35) |
| InChIKey | HKMNGJQJVBRNIX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|