C24H22N2O5 — CID 4242051
N-[3-(2,3-dihydroindol-1-yl)-1-(3,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]furan-2-carboxamide (PubChem CID 4242051) has the molecular formula C24H22N2O5 and a molecular weight of 418.45 g/mol. Its IUPAC name is N-[3-(2,3-dihydroindol-1-yl)-1-(3,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]furan-2-carboxamide.
| Compound Name | N-[3-(2,3-dihydroindol-1-yl)-1-(3,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 4242051 |
| Molecular Formula | C24H22N2O5 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | N-[3-(2,3-dihydroindol-1-yl)-1-(3,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]furan-2-carboxamide |
| SMILES | COc1ccc(C=C(NC(=O)c2ccco2)C(=O)N2CCc3ccccc32)cc1OC |
| InChI | InChI=1S/C24H22N2O5/c1-29-20-10-9-16(15-22(20)30-2)14-18(25-23(27)21-8-5-13-31-21)24(28)26-12-11-17-6-3-4-7-19(17)26/h3-10,13-15H,11-12H2,1-2H3,(H,25,27) |
| InChIKey | AYCWENVGVXTMPA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|