C24H27N3O6 — CID 46262195
N-[(Z)-3-(2-hydroxyethylamino)-1-(1-methylindol-3-yl)-3-oxoprop-1-en-2-yl]-3,4,5-trimethoxybenzamide (PubChem CID 46262195) has the molecular formula C24H27N3O6 and a molecular weight of 453.50 g/mol. Its IUPAC name is N-[(Z)-3-(2-hydroxyethylamino)-1-(1-methylindol-3-yl)-3-oxoprop-1-en-2-yl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(Z)-3-(2-hydroxyethylamino)-1-(1-methylindol-3-yl)-3-oxoprop-1-en-2-yl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 46262195 |
| Molecular Formula | C24H27N3O6 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | N-[(Z)-3-(2-hydroxyethylamino)-1-(1-methylindol-3-yl)-3-oxoprop-1-en-2-yl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)N/C(=C\c2cn(C)c3ccccc23)C(=O)NCCO)cc(OC)c1OC |
| InChI | InChI=1S/C24H27N3O6/c1-27-14-16(17-7-5-6-8-19(17)27)11-18(24(30)25-9-10-28)26-23(29)15-12-20(31-2)22(33-4)21(13-15)32-3/h5-8,11-14,28H,9-10H2,1-4H3,(H,25,30)(H,26,29)/b18-11- |
| InChIKey | ONZMQZJSFBEQNC-WQRHYEAKSA-N |
| XLogP | 2.08 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|