C22H23N3O4 — CID 3750925
N-[3-(2-hydroxyethylamino)-1-(1-methylindol-3-yl)-3-oxoprop-1-en-2-yl]-4-methoxybenzamide (PubChem CID 3750925) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is N-[3-(2-hydroxyethylamino)-1-(1-methylindol-3-yl)-3-oxoprop-1-en-2-yl]-4-methoxybenzamide.
| Compound Name | N-[3-(2-hydroxyethylamino)-1-(1-methylindol-3-yl)-3-oxoprop-1-en-2-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 3750925 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-[3-(2-hydroxyethylamino)-1-(1-methylindol-3-yl)-3-oxoprop-1-en-2-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(=Cc2cn(C)c3ccccc23)C(=O)NCCO)cc1 |
| InChI | InChI=1S/C22H23N3O4/c1-25-14-16(18-5-3-4-6-20(18)25)13-19(22(28)23-11-12-26)24-21(27)15-7-9-17(29-2)10-8-15/h3-10,13-14,26H,11-12H2,1-2H3,(H,23,28)(H,24,27) |
| InChIKey | YTHZRSQTNFWFNP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|