C32H32N4O5 — CID 4873734
3,4-dimethoxy-N-[3-[2-(5-methoxy-1H-indol-3-yl)ethylamino]-1-(1-methylindol-3-yl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 4873734) has the molecular formula C32H32N4O5 and a molecular weight of 552.63 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[3-[2-(5-methoxy-1H-indol-3-yl)ethylamino]-1-(1-methylindol-3-yl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[3-[2-(5-methoxy-1H-indol-3-yl)ethylamino]-1-(1-methylindol-3-yl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 4873734 |
| Molecular Formula | C32H32N4O5 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | 3,4-dimethoxy-N-[3-[2-(5-methoxy-1H-indol-3-yl)ethylamino]-1-(1-methylindol-3-yl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc2[nH]cc(CCNC(=O)C(=Cc3cn(C)c4ccccc34)NC(=O)c3ccc(OC)c(OC)c3)c2c1 |
| InChI | InChI=1S/C32H32N4O5/c1-36-19-22(24-7-5-6-8-28(24)36)15-27(35-31(37)20-9-12-29(40-3)30(16-20)41-4)32(38)33-14-13-21-18-34-26-11-10-23(39-2)17-25(21)26/h5-12,15-19,34H,13-14H2,1-4H3,(H,33,38)(H,35,37) |
| InChIKey | NQCIJWLVTUVSSG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|