C27H23Cl2N3O3 — CID 87047723
N-[(Z)-3-[2-(2,4-dichlorophenyl)ethylamino]-1-(5-methoxy-1H-indol-3-yl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 87047723) has the molecular formula C27H23Cl2N3O3 and a molecular weight of 508.41 g/mol. Its IUPAC name is N-[(Z)-3-[2-(2,4-dichlorophenyl)ethylamino]-1-(5-methoxy-1H-indol-3-yl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[2-(2,4-dichlorophenyl)ethylamino]-1-(5-methoxy-1H-indol-3-yl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 87047723 |
| Molecular Formula | C27H23Cl2N3O3 |
| Molecular Weight | 508.41 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | N-[(Z)-3-[2-(2,4-dichlorophenyl)ethylamino]-1-(5-methoxy-1H-indol-3-yl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc2[nH]cc(/C=C(\NC(=O)c3ccccc3)C(=O)NCCc3ccc(Cl)cc3Cl)c2c1 |
| InChI | InChI=1S/C27H23Cl2N3O3/c1-35-21-9-10-24-22(15-21)19(16-31-24)13-25(32-26(33)18-5-3-2-4-6-18)27(34)30-12-11-17-7-8-20(28)14-23(17)29/h2-10,13-16,31H,11-12H2,1H3,(H,30,34)(H,32,33)/b25-13- |
| InChIKey | DGPAYGQYMOFGJB-MXAYSNPKSA-N |
| XLogP | 5.61 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.41 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|