C21H19N3O5 — CID 171983393
2-[[(E)-3-(1H-indol-3-yl)-2-[(4-methoxybenzoyl)amino]prop-2-enoyl]amino]acetic acid (PubChem CID 171983393) has the molecular formula C21H19N3O5 and a molecular weight of 393.40 g/mol. Its IUPAC name is 2-[[(E)-3-(1H-indol-3-yl)-2-[(4-methoxybenzoyl)amino]prop-2-enoyl]amino]acetic acid.
| Compound Name | 2-[[(E)-3-(1H-indol-3-yl)-2-[(4-methoxybenzoyl)amino]prop-2-enoyl]amino]acetic acid |
|---|---|
| PubChem CID | 171983393 |
| Molecular Formula | C21H19N3O5 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 2-[[(E)-3-(1H-indol-3-yl)-2-[(4-methoxybenzoyl)amino]prop-2-enoyl]amino]acetic acid |
| SMILES | COc1ccc(C(=O)N/C(=C/c2c[nH]c3ccccc23)C(=O)NCC(=O)O)cc1 |
| InChI | InChI=1S/C21H19N3O5/c1-29-15-8-6-13(7-9-15)20(27)24-18(21(28)23-12-19(25)26)10-14-11-22-17-5-3-2-4-16(14)17/h2-11,22H,12H2,1H3,(H,23,28)(H,24,27)(H,25,26)/b18-10+ |
| InChIKey | FYACTHYCZIFLPO-VCHYOVAHSA-N |
| XLogP | 2.15 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|