C23H25N3O4 — CID 99935208
N-[(Z)-1-(5-methoxy-1H-indol-3-yl)-3-[[(2R)-1-methoxypropan-2-yl]amino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 99935208) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is N-[(Z)-1-(5-methoxy-1H-indol-3-yl)-3-[[(2R)-1-methoxypropan-2-yl]amino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(5-methoxy-1H-indol-3-yl)-3-[[(2R)-1-methoxypropan-2-yl]amino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 99935208 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | N-[(Z)-1-(5-methoxy-1H-indol-3-yl)-3-[[(2R)-1-methoxypropan-2-yl]amino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COC[C@@H](C)NC(=O)/C(=C/c1c[nH]c2ccc(OC)cc12)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H25N3O4/c1-15(14-29-2)25-23(28)21(26-22(27)16-7-5-4-6-8-16)11-17-13-24-20-10-9-18(30-3)12-19(17)20/h4-13,15,24H,14H2,1-3H3,(H,25,28)(H,26,27)/b21-11-/t15-/m1/s1 |
| InChIKey | YVQOYUQCUBBWOZ-ZGFXFUDXSA-N |
| XLogP | 3.10 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|