C28H27N3O5 — CID 124658230
N-[(E)-1-(1H-indol-3-yl)-3-oxo-3-[(3,4,5-trimethoxyphenyl)methylamino]prop-1-en-2-yl]benzamide (PubChem CID 124658230) has the molecular formula C28H27N3O5 and a molecular weight of 485.54 g/mol. Its IUPAC name is N-[(E)-1-(1H-indol-3-yl)-3-oxo-3-[(3,4,5-trimethoxyphenyl)methylamino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(1H-indol-3-yl)-3-oxo-3-[(3,4,5-trimethoxyphenyl)methylamino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 124658230 |
| Molecular Formula | C28H27N3O5 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | N-[(E)-1-(1H-indol-3-yl)-3-oxo-3-[(3,4,5-trimethoxyphenyl)methylamino]prop-1-en-2-yl]benzamide |
| SMILES | COc1cc(CNC(=O)/C(=C\c2c[nH]c3ccccc23)NC(=O)c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C28H27N3O5/c1-34-24-13-18(14-25(35-2)26(24)36-3)16-30-28(33)23(31-27(32)19-9-5-4-6-10-19)15-20-17-29-22-12-8-7-11-21(20)22/h4-15,17,29H,16H2,1-3H3,(H,30,33)(H,31,32)/b23-15+ |
| InChIKey | RBCPCACDDRUROB-HZHRSRAPSA-N |
| XLogP | 4.28 |
| TPSA | 101.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|