C27H24FN3O3 — CID 87047745
N-[(Z)-3-[2-(2-fluorophenyl)ethylamino]-1-(5-methoxy-1H-indol-3-yl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 87047745) has the molecular formula C27H24FN3O3 and a molecular weight of 457.51 g/mol. Its IUPAC name is N-[(Z)-3-[2-(2-fluorophenyl)ethylamino]-1-(5-methoxy-1H-indol-3-yl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[2-(2-fluorophenyl)ethylamino]-1-(5-methoxy-1H-indol-3-yl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 87047745 |
| Molecular Formula | C27H24FN3O3 |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | N-[(Z)-3-[2-(2-fluorophenyl)ethylamino]-1-(5-methoxy-1H-indol-3-yl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc2[nH]cc(/C=C(\NC(=O)c3ccccc3)C(=O)NCCc3ccccc3F)c2c1 |
| InChI | InChI=1S/C27H24FN3O3/c1-34-21-11-12-24-22(16-21)20(17-30-24)15-25(31-26(32)19-8-3-2-4-9-19)27(33)29-14-13-18-7-5-6-10-23(18)28/h2-12,15-17,30H,13-14H2,1H3,(H,29,33)(H,31,32)/b25-15- |
| InChIKey | OHOCJOHLEHXJSX-MYYYXRDXSA-N |
| XLogP | 4.45 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|