C28H36N4O5 — CID 3887374
N-[3-[2-(diethylamino)ethylamino]-1-(1-methylindol-3-yl)-3-oxoprop-1-en-2-yl]-3,4,5-trimethoxybenzamide (PubChem CID 3887374) has the molecular formula C28H36N4O5 and a molecular weight of 508.62 g/mol. Its IUPAC name is N-[3-[2-(diethylamino)ethylamino]-1-(1-methylindol-3-yl)-3-oxoprop-1-en-2-yl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[3-[2-(diethylamino)ethylamino]-1-(1-methylindol-3-yl)-3-oxoprop-1-en-2-yl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 3887374 |
| Molecular Formula | C28H36N4O5 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | N-[3-[2-(diethylamino)ethylamino]-1-(1-methylindol-3-yl)-3-oxoprop-1-en-2-yl]-3,4,5-trimethoxybenzamide |
| SMILES | CCN(CC)CCNC(=O)C(=Cc1cn(C)c2ccccc12)NC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C28H36N4O5/c1-7-32(8-2)14-13-29-28(34)22(15-20-18-31(3)23-12-10-9-11-21(20)23)30-27(33)19-16-24(35-4)26(37-6)25(17-19)36-5/h9-12,15-18H,7-8,13-14H2,1-6H3,(H,29,34)(H,30,33) |
| InChIKey | NPCYJLWCHPNJKF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|