C27H31N3O5 — CID 46262199
3,4,5-trimethoxy-N-[(Z)-1-(1-methylindol-3-yl)-3-oxo-3-piperidin-1-ylprop-1-en-2-yl]benzamide (PubChem CID 46262199) has the molecular formula C27H31N3O5 and a molecular weight of 477.56 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[(Z)-1-(1-methylindol-3-yl)-3-oxo-3-piperidin-1-ylprop-1-en-2-yl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[(Z)-1-(1-methylindol-3-yl)-3-oxo-3-piperidin-1-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 46262199 |
| Molecular Formula | C27H31N3O5 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | 3,4,5-trimethoxy-N-[(Z)-1-(1-methylindol-3-yl)-3-oxo-3-piperidin-1-ylprop-1-en-2-yl]benzamide |
| SMILES | COc1cc(C(=O)N/C(=C\c2cn(C)c3ccccc23)C(=O)N2CCCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C27H31N3O5/c1-29-17-19(20-10-6-7-11-22(20)29)14-21(27(32)30-12-8-5-9-13-30)28-26(31)18-15-23(33-2)25(35-4)24(16-18)34-3/h6-7,10-11,14-17H,5,8-9,12-13H2,1-4H3,(H,28,31)/b21-14- |
| InChIKey | HWUWDCCLWKBWSW-STZFKDTASA-N |
| XLogP | 3.99 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|