C26H29N3O3 — CID 46262149
N-[(Z)-1-(1-ethylindol-3-yl)-3-oxo-3-piperidin-1-ylprop-1-en-2-yl]-2-methoxybenzamide (PubChem CID 46262149) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is N-[(Z)-1-(1-ethylindol-3-yl)-3-oxo-3-piperidin-1-ylprop-1-en-2-yl]-2-methoxybenzamide.
| Compound Name | N-[(Z)-1-(1-ethylindol-3-yl)-3-oxo-3-piperidin-1-ylprop-1-en-2-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 46262149 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | N-[(Z)-1-(1-ethylindol-3-yl)-3-oxo-3-piperidin-1-ylprop-1-en-2-yl]-2-methoxybenzamide |
| SMILES | CCn1cc(/C=C(\NC(=O)c2ccccc2OC)C(=O)N2CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C26H29N3O3/c1-3-28-18-19(20-11-5-7-13-23(20)28)17-22(26(31)29-15-9-4-10-16-29)27-25(30)21-12-6-8-14-24(21)32-2/h5-8,11-14,17-18H,3-4,9-10,15-16H2,1-2H3,(H,27,30)/b22-17- |
| InChIKey | XFOWUERCJLPWBI-XLNRJJMWSA-N |
| XLogP | 4.45 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|