C26H37ClN2O6 — CID 139594638
N-[2-(diethylamino)ethyl]-2-(3,4-dimethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide;hydrochloride (PubChem CID 139594638) has the molecular formula C26H37ClN2O6 and a molecular weight of 509.04 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-2-(3,4-dimethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide;hydrochloride.
| Compound Name | N-[2-(diethylamino)ethyl]-2-(3,4-dimethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 139594638 |
| Molecular Formula | C26H37ClN2O6 |
| Molecular Weight | 509.04 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-2-(3,4-dimethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide;hydrochloride |
| SMILES | CCN(CC)CCNC(=O)C(=Cc1cc(OC)c(OC)c(OC)c1)c1ccc(OC)c(OC)c1.Cl |
| InChI | InChI=1S/C26H36N2O6.ClH/c1-8-28(9-2)13-12-27-26(29)20(19-10-11-21(30-3)22(17-19)31-4)14-18-15-23(32-5)25(34-7)24(16-18)33-6;/h10-11,14-17H,8-9,12-13H2,1-7H3,(H,27,29);1H |
| InChIKey | CWFBJVXTLQLUQJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.04 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|