C21H23NO7 — CID 141130025
(E)-2-(3-acetamido-4-methoxyphenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid (PubChem CID 141130025) has the molecular formula C21H23NO7 and a molecular weight of 401.42 g/mol. Its IUPAC name is (E)-2-(3-acetamido-4-methoxyphenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid.
| Compound Name | (E)-2-(3-acetamido-4-methoxyphenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 141130025 |
| Molecular Formula | C21H23NO7 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | (E)-2-(3-acetamido-4-methoxyphenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid |
| SMILES | COc1ccc(/C(=C\c2cc(OC)c(OC)c(OC)c2)C(=O)O)cc1NC(C)=O |
| InChI | InChI=1S/C21H23NO7/c1-12(23)22-16-11-14(6-7-17(16)26-2)15(21(24)25)8-13-9-18(27-3)20(29-5)19(10-13)28-4/h6-11H,1-5H3,(H,22,23)(H,24,25)/b15-8+ |
| InChIKey | WGOVKJRVTCKBQY-OVCLIPMQSA-N |
| XLogP | 3.30 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|