C22H25NO7S — CID 71767045
(E)-3-[4-(dimethylcarbamothioyloxy)-3-methoxyphenyl]-2-(3,4,5-trimethoxyphenyl)prop-2-enoic acid (PubChem CID 71767045) has the molecular formula C22H25NO7S and a molecular weight of 447.51 g/mol. Its IUPAC name is (E)-3-[4-(dimethylcarbamothioyloxy)-3-methoxyphenyl]-2-(3,4,5-trimethoxyphenyl)prop-2-enoic acid.
| Compound Name | (E)-3-[4-(dimethylcarbamothioyloxy)-3-methoxyphenyl]-2-(3,4,5-trimethoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 71767045 |
| Molecular Formula | C22H25NO7S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | (E)-3-[4-(dimethylcarbamothioyloxy)-3-methoxyphenyl]-2-(3,4,5-trimethoxyphenyl)prop-2-enoic acid |
| SMILES | COc1cc(/C=C(/C(=O)O)c2cc(OC)c(OC)c(OC)c2)ccc1OC(=S)N(C)C |
| InChI | InChI=1S/C22H25NO7S/c1-23(2)22(31)30-16-8-7-13(10-17(16)26-3)9-15(21(24)25)14-11-18(27-4)20(29-6)19(12-14)28-5/h7-12H,1-6H3,(H,24,25)/b15-9+ |
| InChIKey | STSRAZSLYXOUQC-OQLLNIDSSA-N |
| XLogP | 3.57 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|