C25H32O8 — CID 73056336
(E)-3-[4-methoxy-2,3-di(propan-2-yloxy)phenyl]-2-(3,4,5-trimethoxyphenyl)prop-2-enoic acid (PubChem CID 73056336) has the molecular formula C25H32O8 and a molecular weight of 460.52 g/mol. Its IUPAC name is (E)-3-[4-methoxy-2,3-di(propan-2-yloxy)phenyl]-2-(3,4,5-trimethoxyphenyl)prop-2-enoic acid.
| Compound Name | (E)-3-[4-methoxy-2,3-di(propan-2-yloxy)phenyl]-2-(3,4,5-trimethoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 73056336 |
| Molecular Formula | C25H32O8 |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | (E)-3-[4-methoxy-2,3-di(propan-2-yloxy)phenyl]-2-(3,4,5-trimethoxyphenyl)prop-2-enoic acid |
| SMILES | COc1cc(/C(=C\c2ccc(OC)c(OC(C)C)c2OC(C)C)C(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C25H32O8/c1-14(2)32-22-16(9-10-19(28-5)24(22)33-15(3)4)11-18(25(26)27)17-12-20(29-6)23(31-8)21(13-17)30-7/h9-15H,1-8H3,(H,26,27)/b18-11+ |
| InChIKey | VJLRCWCWAQEPEH-WOJGMQOQSA-N |
| XLogP | 4.92 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|