C16H15NO3 — CID 83956035
(Z)-2-(4-methoxy-3-methylphenyl)-3-pyridin-4-ylprop-2-enoic acid (PubChem CID 83956035) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is (Z)-2-(4-methoxy-3-methylphenyl)-3-pyridin-4-ylprop-2-enoic acid.
| Compound Name | (Z)-2-(4-methoxy-3-methylphenyl)-3-pyridin-4-ylprop-2-enoic acid |
|---|---|
| PubChem CID | 83956035 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | (Z)-2-(4-methoxy-3-methylphenyl)-3-pyridin-4-ylprop-2-enoic acid |
| SMILES | COc1ccc(/C(=C/c2ccncc2)C(=O)O)cc1C |
| InChI | InChI=1S/C16H15NO3/c1-11-9-13(3-4-15(11)20-2)14(16(18)19)10-12-5-7-17-8-6-12/h3-10H,1-2H3,(H,18,19)/b14-10- |
| InChIKey | HNEBZPITTOBNTB-UVTDQMKNSA-N |
| XLogP | 3.02 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|