C17H14ClFO3 — CID 83952941
(Z)-3-(2-chloro-6-fluorophenyl)-2-(4-methoxy-3-methylphenyl)prop-2-enoic acid (PubChem CID 83952941) has the molecular formula C17H14ClFO3 and a molecular weight of 320.75 g/mol. Its IUPAC name is (Z)-3-(2-chloro-6-fluorophenyl)-2-(4-methoxy-3-methylphenyl)prop-2-enoic acid.
| Compound Name | (Z)-3-(2-chloro-6-fluorophenyl)-2-(4-methoxy-3-methylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 83952941 |
| Molecular Formula | C17H14ClFO3 |
| Molecular Weight | 320.75 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | (Z)-3-(2-chloro-6-fluorophenyl)-2-(4-methoxy-3-methylphenyl)prop-2-enoic acid |
| SMILES | COc1ccc(/C(=C/c2c(F)cccc2Cl)C(=O)O)cc1C |
| InChI | InChI=1S/C17H14ClFO3/c1-10-8-11(6-7-16(10)22-2)12(17(20)21)9-13-14(18)4-3-5-15(13)19/h3-9H,1-2H3,(H,20,21)/b12-9- |
| InChIKey | FEYLEPNANWERKI-XFXZXTDPSA-N |
| XLogP | 4.42 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.75 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|