C17H14ClFO2 — CID 83952932
(Z)-3-(2-chloro-6-fluorophenyl)-2-(2,5-dimethylphenyl)prop-2-enoic acid (PubChem CID 83952932) has the molecular formula C17H14ClFO2 and a molecular weight of 304.75 g/mol. Its IUPAC name is (Z)-3-(2-chloro-6-fluorophenyl)-2-(2,5-dimethylphenyl)prop-2-enoic acid.
| Compound Name | (Z)-3-(2-chloro-6-fluorophenyl)-2-(2,5-dimethylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 83952932 |
| Molecular Formula | C17H14ClFO2 |
| Molecular Weight | 304.75 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | (Z)-3-(2-chloro-6-fluorophenyl)-2-(2,5-dimethylphenyl)prop-2-enoic acid |
| SMILES | Cc1ccc(C)c(/C(=C/c2c(F)cccc2Cl)C(=O)O)c1 |
| InChI | InChI=1S/C17H14ClFO2/c1-10-6-7-11(2)12(8-10)13(17(20)21)9-14-15(18)4-3-5-16(14)19/h3-9H,1-2H3,(H,20,21)/b13-9- |
| InChIKey | GUUWCOLPXJQCGJ-LCYFTJDESA-N |
| XLogP | 4.72 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.75 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|