C23H26N4O5S — CID 46261985
N-[(Z)-1-[1-(dimethylsulfamoyl)indol-3-yl]-3-(3-hydroxypropylamino)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 46261985) has the molecular formula C23H26N4O5S and a molecular weight of 470.55 g/mol. Its IUPAC name is N-[(Z)-1-[1-(dimethylsulfamoyl)indol-3-yl]-3-(3-hydroxypropylamino)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-[1-(dimethylsulfamoyl)indol-3-yl]-3-(3-hydroxypropylamino)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 46261985 |
| Molecular Formula | C23H26N4O5S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | N-[(Z)-1-[1-(dimethylsulfamoyl)indol-3-yl]-3-(3-hydroxypropylamino)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CN(C)S(=O)(=O)n1cc(/C=C(\NC(=O)c2ccccc2)C(=O)NCCCO)c2ccccc21 |
| InChI | InChI=1S/C23H26N4O5S/c1-26(2)33(31,32)27-16-18(19-11-6-7-12-21(19)27)15-20(23(30)24-13-8-14-28)25-22(29)17-9-4-3-5-10-17/h3-7,9-12,15-16,28H,8,13-14H2,1-2H3,(H,24,30)(H,25,29)/b20-15- |
| InChIKey | BLSZITWNWAUOIX-HKWRFOASSA-N |
| XLogP | 1.57 |
| TPSA | 120.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|