C31H34N4O7S — CID 46262042
N-[(Z)-3-[2-(3,4-dimethoxyphenyl)ethylamino]-1-[1-(dimethylsulfamoyl)indol-3-yl]-3-oxoprop-1-en-2-yl]-2-methoxybenzamide (PubChem CID 46262042) has the molecular formula C31H34N4O7S and a molecular weight of 606.70 g/mol. Its IUPAC name is N-[(Z)-3-[2-(3,4-dimethoxyphenyl)ethylamino]-1-[1-(dimethylsulfamoyl)indol-3-yl]-3-oxoprop-1-en-2-yl]-2-methoxybenzamide.
| Compound Name | N-[(Z)-3-[2-(3,4-dimethoxyphenyl)ethylamino]-1-[1-(dimethylsulfamoyl)indol-3-yl]-3-oxoprop-1-en-2-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 46262042 |
| Molecular Formula | C31H34N4O7S |
| Molecular Weight | 606.70 g/mol |
| Exact Mass | 606.21 |
| IUPAC Name | N-[(Z)-3-[2-(3,4-dimethoxyphenyl)ethylamino]-1-[1-(dimethylsulfamoyl)indol-3-yl]-3-oxoprop-1-en-2-yl]-2-methoxybenzamide |
| SMILES | COc1ccc(CCNC(=O)/C(=C/c2cn(S(=O)(=O)N(C)C)c3ccccc23)NC(=O)c2ccccc2OC)cc1OC |
| InChI | InChI=1S/C31H34N4O7S/c1-34(2)43(38,39)35-20-22(23-10-6-8-12-26(23)35)19-25(33-30(36)24-11-7-9-13-27(24)40-3)31(37)32-17-16-21-14-15-28(41-4)29(18-21)42-5/h6-15,18-20H,16-17H2,1-5H3,(H,32,37)(H,33,36)/b25-19- |
| InChIKey | YRIWAXVUHYMKRS-PLRJNAJWSA-N |
| XLogP | 3.45 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.70 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|