C28H36N4O7S — CID 4580393
N-[3-[butyl(methyl)amino]-1-[1-(dimethylsulfamoyl)indol-3-yl]-3-oxoprop-1-en-2-yl]-3,4,5-trimethoxybenzamide (PubChem CID 4580393) has the molecular formula C28H36N4O7S and a molecular weight of 572.68 g/mol. Its IUPAC name is N-[3-[butyl(methyl)amino]-1-[1-(dimethylsulfamoyl)indol-3-yl]-3-oxoprop-1-en-2-yl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[3-[butyl(methyl)amino]-1-[1-(dimethylsulfamoyl)indol-3-yl]-3-oxoprop-1-en-2-yl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 4580393 |
| Molecular Formula | C28H36N4O7S |
| Molecular Weight | 572.68 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | N-[3-[butyl(methyl)amino]-1-[1-(dimethylsulfamoyl)indol-3-yl]-3-oxoprop-1-en-2-yl]-3,4,5-trimethoxybenzamide |
| SMILES | CCCCN(C)C(=O)C(=Cc1cn(S(=O)(=O)N(C)C)c2ccccc12)NC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C28H36N4O7S/c1-8-9-14-31(4)28(34)22(29-27(33)19-16-24(37-5)26(39-7)25(17-19)38-6)15-20-18-32(40(35,36)30(2)3)23-13-11-10-12-21(20)23/h10-13,15-18H,8-9,14H2,1-7H3,(H,29,33) |
| InChIKey | AJTGXIKLXGGHNV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.68 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|