C25H28FN5O4S — CID 3591559
N-[1-[1-(dimethylsulfamoyl)indol-3-yl]-3-(4-methylpiperazin-1-yl)-3-oxoprop-1-en-2-yl]-2-fluorobenzamide (PubChem CID 3591559) has the molecular formula C25H28FN5O4S and a molecular weight of 513.60 g/mol. Its IUPAC name is N-[1-[1-(dimethylsulfamoyl)indol-3-yl]-3-(4-methylpiperazin-1-yl)-3-oxoprop-1-en-2-yl]-2-fluorobenzamide.
| Compound Name | N-[1-[1-(dimethylsulfamoyl)indol-3-yl]-3-(4-methylpiperazin-1-yl)-3-oxoprop-1-en-2-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 3591559 |
| Molecular Formula | C25H28FN5O4S |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | N-[1-[1-(dimethylsulfamoyl)indol-3-yl]-3-(4-methylpiperazin-1-yl)-3-oxoprop-1-en-2-yl]-2-fluorobenzamide |
| SMILES | CN1CCN(C(=O)C(=Cc2cn(S(=O)(=O)N(C)C)c3ccccc23)NC(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C25H28FN5O4S/c1-28(2)36(34,35)31-17-18(19-8-5-7-11-23(19)31)16-22(25(33)30-14-12-29(3)13-15-30)27-24(32)20-9-4-6-10-21(20)26/h4-11,16-17H,12-15H2,1-3H3,(H,27,32) |
| InChIKey | UUIDUDBDMJQGPA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 94.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|