C26H29ClN4O3 — CID 53400009
N-[1-(2-chloro-7-methoxyquinolin-3-yl)-3-[2-(diethylamino)ethylamino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 53400009) has the molecular formula C26H29ClN4O3 and a molecular weight of 481.00 g/mol. Its IUPAC name is N-[1-(2-chloro-7-methoxyquinolin-3-yl)-3-[2-(diethylamino)ethylamino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[1-(2-chloro-7-methoxyquinolin-3-yl)-3-[2-(diethylamino)ethylamino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 53400009 |
| Molecular Formula | C26H29ClN4O3 |
| Molecular Weight | 481.00 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | N-[1-(2-chloro-7-methoxyquinolin-3-yl)-3-[2-(diethylamino)ethylamino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCN(CC)CCNC(=O)C(=Cc1cc2ccc(OC)cc2nc1Cl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H29ClN4O3/c1-4-31(5-2)14-13-28-26(33)23(30-25(32)18-9-7-6-8-10-18)16-20-15-19-11-12-21(34-3)17-22(19)29-24(20)27/h6-12,15-17H,4-5,13-14H2,1-3H3,(H,28,33)(H,30,32) |
| InChIKey | MRTUKVGWIBUVOQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.00 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|