C25H20ClN3O4 — CID 22308301
N-[(Z)-1-(2-chloro-7-methoxyquinolin-3-yl)-3-[furan-2-yl(methyl)amino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22308301) has the molecular formula C25H20ClN3O4 and a molecular weight of 461.91 g/mol. Its IUPAC name is N-[(Z)-1-(2-chloro-7-methoxyquinolin-3-yl)-3-[furan-2-yl(methyl)amino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2-chloro-7-methoxyquinolin-3-yl)-3-[furan-2-yl(methyl)amino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22308301 |
| Molecular Formula | C25H20ClN3O4 |
| Molecular Weight | 461.91 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | N-[(Z)-1-(2-chloro-7-methoxyquinolin-3-yl)-3-[furan-2-yl(methyl)amino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc2cc(/C=C(\NC(=O)c3ccccc3)C(=O)N(C)c3ccco3)c(Cl)nc2c1 |
| InChI | InChI=1S/C25H20ClN3O4/c1-29(22-9-6-12-33-22)25(31)21(28-24(30)16-7-4-3-5-8-16)14-18-13-17-10-11-19(32-2)15-20(17)27-23(18)26/h3-15H,1-2H3,(H,28,30)/b21-14- |
| InChIKey | XWDIBJMYTPBNPM-STZFKDTASA-N |
| XLogP | 4.92 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.91 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|