C26H23ClN4O4S — CID 94838497
4-[benzyl(methylsulfonyl)amino]-N-[(Z)-(2-chloro-7-methoxyquinolin-3-yl)methylideneamino]benzamide (PubChem CID 94838497) has the molecular formula C26H23ClN4O4S and a molecular weight of 523.01 g/mol. Its IUPAC name is 4-[benzyl(methylsulfonyl)amino]-N-[(Z)-(2-chloro-7-methoxyquinolin-3-yl)methylideneamino]benzamide.
| Compound Name | 4-[benzyl(methylsulfonyl)amino]-N-[(Z)-(2-chloro-7-methoxyquinolin-3-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 94838497 |
| Molecular Formula | C26H23ClN4O4S |
| Molecular Weight | 523.01 g/mol |
| Exact Mass | 522.11 |
| IUPAC Name | 4-[benzyl(methylsulfonyl)amino]-N-[(Z)-(2-chloro-7-methoxyquinolin-3-yl)methylideneamino]benzamide |
| SMILES | COc1ccc2cc(/C=N\NC(=O)c3ccc(N(Cc4ccccc4)S(C)(=O)=O)cc3)c(Cl)nc2c1 |
| InChI | InChI=1S/C26H23ClN4O4S/c1-35-23-13-10-20-14-21(25(27)29-24(20)15-23)16-28-30-26(32)19-8-11-22(12-9-19)31(36(2,33)34)17-18-6-4-3-5-7-18/h3-16H,17H2,1-2H3,(H,30,32)/b28-16- |
| InChIKey | RNDYFVUUWLOQAZ-NTFVMDSBSA-N |
| XLogP | 4.63 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.01 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|