C28H27ClN4O4S — CID 1117095
N-[(2-chloro-7-methoxyquinolin-3-yl)methylideneamino]-4-[(3,4-dimethyl-N-methylsulfonylanilino)methyl]benzamide (PubChem CID 1117095) has the molecular formula C28H27ClN4O4S and a molecular weight of 551.07 g/mol. Its IUPAC name is N-[(2-chloro-7-methoxyquinolin-3-yl)methylideneamino]-4-[(3,4-dimethyl-N-methylsulfonylanilino)methyl]benzamide.
| Compound Name | N-[(2-chloro-7-methoxyquinolin-3-yl)methylideneamino]-4-[(3,4-dimethyl-N-methylsulfonylanilino)methyl]benzamide |
|---|---|
| PubChem CID | 1117095 |
| Molecular Formula | C28H27ClN4O4S |
| Molecular Weight | 551.07 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | N-[(2-chloro-7-methoxyquinolin-3-yl)methylideneamino]-4-[(3,4-dimethyl-N-methylsulfonylanilino)methyl]benzamide |
| SMILES | COc1ccc2cc(C=NNC(=O)c3ccc(CN(c4ccc(C)c(C)c4)S(C)(=O)=O)cc3)c(Cl)nc2c1 |
| InChI | InChI=1S/C28H27ClN4O4S/c1-18-5-11-24(13-19(18)2)33(38(4,35)36)17-20-6-8-21(9-7-20)28(34)32-30-16-23-14-22-10-12-25(37-3)15-26(22)31-27(23)29/h5-16H,17H2,1-4H3,(H,32,34) |
| InChIKey | KACUWYOZYFOQBA-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.07 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|