C23H25N3O3S2 — CID 92661635
4-[(3,4-dimethyl-N-methylsulfonylanilino)methyl]-N-[(Z)-(3-methylthiophen-2-yl)methylideneamino]benzamide (PubChem CID 92661635) has the molecular formula C23H25N3O3S2 and a molecular weight of 455.61 g/mol. Its IUPAC name is 4-[(3,4-dimethyl-N-methylsulfonylanilino)methyl]-N-[(Z)-(3-methylthiophen-2-yl)methylideneamino]benzamide.
| Compound Name | 4-[(3,4-dimethyl-N-methylsulfonylanilino)methyl]-N-[(Z)-(3-methylthiophen-2-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 92661635 |
| Molecular Formula | C23H25N3O3S2 |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 4-[(3,4-dimethyl-N-methylsulfonylanilino)methyl]-N-[(Z)-(3-methylthiophen-2-yl)methylideneamino]benzamide |
| SMILES | Cc1ccc(N(Cc2ccc(C(=O)N/N=C\c3sccc3C)cc2)S(C)(=O)=O)cc1C |
| InChI | InChI=1S/C23H25N3O3S2/c1-16-5-10-21(13-18(16)3)26(31(4,28)29)15-19-6-8-20(9-7-19)23(27)25-24-14-22-17(2)11-12-30-22/h5-14H,15H2,1-4H3,(H,25,27)/b24-14- |
| InChIKey | BKTCZWCFRCOHKM-OYKKKHCWSA-N |
| XLogP | 4.40 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|