C26H24N2O7 — CID 19057436
3-[[(Z)-2-benzamido-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]-4-methoxybenzoic acid (PubChem CID 19057436) has the molecular formula C26H24N2O7 and a molecular weight of 476.49 g/mol. Its IUPAC name is 3-[[(Z)-2-benzamido-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]-4-methoxybenzoic acid.
| Compound Name | 3-[[(Z)-2-benzamido-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 19057436 |
| Molecular Formula | C26H24N2O7 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 3-[[(Z)-2-benzamido-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]-4-methoxybenzoic acid |
| SMILES | COc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2cc(C(=O)O)ccc2OC)c(OC)c1 |
| InChI | InChI=1S/C26H24N2O7/c1-33-19-11-9-17(23(15-19)35-3)13-21(28-24(29)16-7-5-4-6-8-16)25(30)27-20-14-18(26(31)32)10-12-22(20)34-2/h4-15H,1-3H3,(H,27,30)(H,28,29)(H,31,32)/b21-13- |
| InChIKey | OUZGXZVJCMADAA-BKUYFWCQSA-N |
| XLogP | 3.82 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|