C24H18F2N2O5 — CID 19057351
3-[[(Z)-2-benzamido-3-(3,4-difluorophenyl)prop-2-enoyl]amino]-4-methoxybenzoic acid (PubChem CID 19057351) has the molecular formula C24H18F2N2O5 and a molecular weight of 452.41 g/mol. Its IUPAC name is 3-[[(Z)-2-benzamido-3-(3,4-difluorophenyl)prop-2-enoyl]amino]-4-methoxybenzoic acid.
| Compound Name | 3-[[(Z)-2-benzamido-3-(3,4-difluorophenyl)prop-2-enoyl]amino]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 19057351 |
| Molecular Formula | C24H18F2N2O5 |
| Molecular Weight | 452.41 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 3-[[(Z)-2-benzamido-3-(3,4-difluorophenyl)prop-2-enoyl]amino]-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1NC(=O)/C(=C/c1ccc(F)c(F)c1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H18F2N2O5/c1-33-21-10-8-16(24(31)32)13-19(21)27-23(30)20(12-14-7-9-17(25)18(26)11-14)28-22(29)15-5-3-2-4-6-15/h2-13H,1H3,(H,27,30)(H,28,29)(H,31,32)/b20-12- |
| InChIKey | MZSVTCYWRBVWMZ-NDENLUEZSA-N |
| XLogP | 4.08 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|